C27H30BrFN6O5 — CID 145256787
4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-(3,4-dihydroxybutyl)pyrazol-4-yl]phenyl]piperidine-1-carboxamide (PubChem CID 145256787) has the molecular formula C27H30BrFN6O5 and a molecular weight of 617.48 g/mol. Its IUPAC name is 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-(3,4-dihydroxybutyl)pyrazol-4-yl]phenyl]piperidine-1-carboxamide.
| Compound Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-(3,4-dihydroxybutyl)pyrazol-4-yl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 145256787 |
| Molecular Formula | C27H30BrFN6O5 |
| Molecular Weight | 617.48 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | 4-[2-(3-bromo-4-fluorophenyl)imino-2-(hydroxyamino)acetyl]-N-[4-[1-(3,4-dihydroxybutyl)pyrazol-4-yl]phenyl]piperidine-1-carboxamide |
| SMILES | O=C(/C(=N/c1ccc(F)c(Br)c1)NO)C1CCN(C(=O)Nc2ccc(-c3cnn(CCC(O)CO)c3)cc2)CC1 |
| InChI | InChI=1S/C27H30BrFN6O5/c28-23-13-21(5-6-24(23)29)31-26(33-40)25(38)18-7-10-34(11-8-18)27(39)32-20-3-1-17(2-4-20)19-14-30-35(15-19)12-9-22(37)16-36/h1-6,13-15,18,22,36-37,40H,7-12,16H2,(H,31,33)(H,32,39) |
| InChIKey | ORVDKQUVTPDSLI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|