C17H14N6O3S — CID 16666124
4-[(5-cyano-3-pyridinyl)amino]-8-methyl-6-methylsulfonylcinnoline-3-carboxamide (PubChem CID 16666124) has the molecular formula C17H14N6O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-[(5-cyano-3-pyridinyl)amino]-8-methyl-6-methylsulfonylcinnoline-3-carboxamide.
| Compound Name | 4-[(5-cyano-3-pyridinyl)amino]-8-methyl-6-methylsulfonylcinnoline-3-carboxamide |
|---|---|
| PubChem CID | 16666124 |
| Molecular Formula | C17H14N6O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-[(5-cyano-3-pyridinyl)amino]-8-methyl-6-methylsulfonylcinnoline-3-carboxamide |
| SMILES | Cc1cc(S(C)(=O)=O)cc2c(Nc3cncc(C#N)c3)c(C(N)=O)nnc12 |
| InChI | InChI=1S/C17H14N6O3S/c1-9-3-12(27(2,25)26)5-13-14(9)22-23-16(17(19)24)15(13)21-11-4-10(6-18)7-20-8-11/h3-5,7-8H,1-2H3,(H2,19,24)(H,21,22) |
| InChIKey | WFTUSRXPBXAYOK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |