C29H26N6O — CID 16622995
(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone (PubChem CID 16622995) has the molecular formula C29H26N6O and a molecular weight of 474.57 g/mol. Its IUPAC name is (1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16622995 |
| Molecular Formula | C29H26N6O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn(-c2ccccc2)nc1-c1cccnc1)N1CCN(Cc2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C29H26N6O/c36-29(26-21-35(25-11-2-1-3-12-25)32-28(26)23-10-5-13-30-19-23)34-17-15-33(16-18-34)20-24-8-4-7-22-9-6-14-31-27(22)24/h1-14,19,21H,15-18,20H2 |
| InChIKey | TYMUVBJFAGRRMJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |