C23H21N7O — CID 9397141
(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 9397141) has the molecular formula C23H21N7O and a molecular weight of 411.47 g/mol. Its IUPAC name is (1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 9397141 |
| Molecular Formula | C23H21N7O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cn(-c2ccccc2)nc1-c1cccnc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H21N7O/c31-22(28-12-14-29(15-13-28)23-25-10-5-11-26-23)20-17-30(19-7-2-1-3-8-19)27-21(20)18-6-4-9-24-16-18/h1-11,16-17H,12-15H2 |
| InChIKey | VZDLRURPQACSBO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |