C20H17N7O3 — CID 166230867
1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea (PubChem CID 166230867) has the molecular formula C20H17N7O3 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 166230867 |
| Molecular Formula | C20H17N7O3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)NNC(=O)c2cc3ccccc3cc2O)cc1-n1cnnn1 |
| InChI | InChI=1S/C20H17N7O3/c1-12-6-7-15(10-17(12)27-11-21-25-26-27)22-20(30)24-23-19(29)16-8-13-4-2-3-5-14(13)9-18(16)28/h2-11,28H,1H3,(H,23,29)(H2,22,24,30) |
| InChIKey | FFIWMBDMFVIWDA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|