C25H36N4O3 — CID 166232757
1-(1-cyclohexyl-2-oxopiperidin-3-yl)-3-[2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]urea (PubChem CID 166232757) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2-oxopiperidin-3-yl)-3-[2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(1-cyclohexyl-2-oxopiperidin-3-yl)-3-[2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 166232757 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-(1-cyclohexyl-2-oxopiperidin-3-yl)-3-[2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]urea |
| SMILES | O=C(NC1CCN(CCCc2ccccc2)C1=O)NC1CCCN(C2CCCCC2)C1=O |
| InChI | InChI=1S/C25H36N4O3/c30-23-22(15-18-28(23)16-7-11-19-9-3-1-4-10-19)27-25(32)26-21-14-8-17-29(24(21)31)20-12-5-2-6-13-20/h1,3-4,9-10,20-22H,2,5-8,11-18H2,(H2,26,27,32) |
| InChIKey | CBAFAIBPPOQNQM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |