C16H22ClNO2 — CID 166232983
1-[3-(2-chlorophenoxy)pyrrolidin-1-yl]hex-5-en-2-ol (PubChem CID 166232983) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 1-[3-(2-chlorophenoxy)pyrrolidin-1-yl]hex-5-en-2-ol.
| Compound Name | 1-[3-(2-chlorophenoxy)pyrrolidin-1-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 166232983 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1-[3-(2-chlorophenoxy)pyrrolidin-1-yl]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN1CCC(Oc2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H22ClNO2/c1-2-3-6-13(19)11-18-10-9-14(12-18)20-16-8-5-4-7-15(16)17/h2,4-5,7-8,13-14,19H,1,3,6,9-12H2 |
| InChIKey | WLTOZHHFUQSYJY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|