C25H46N2O3 — CID 166234408
1,3-bis[4-(cyclopentylmethoxy)piperidin-1-yl]propan-2-ol (PubChem CID 166234408) has the molecular formula C25H46N2O3 and a molecular weight of 422.65 g/mol. Its IUPAC name is 1,3-bis[4-(cyclopentylmethoxy)piperidin-1-yl]propan-2-ol.
| Compound Name | 1,3-bis[4-(cyclopentylmethoxy)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 166234408 |
| Molecular Formula | C25H46N2O3 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 1,3-bis[4-(cyclopentylmethoxy)piperidin-1-yl]propan-2-ol |
| SMILES | OC(CN1CCC(OCC2CCCC2)CC1)CN1CCC(OCC2CCCC2)CC1 |
| InChI | InChI=1S/C25H46N2O3/c28-23(17-26-13-9-24(10-14-26)29-19-21-5-1-2-6-21)18-27-15-11-25(12-16-27)30-20-22-7-3-4-8-22/h21-25,28H,1-20H2 |
| InChIKey | YUXZKAQUGWJBKB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |