C19H22N2O3 — CID 166236275
(2S)-N-[(2S,3R)-2-ethenyloxan-3-yl]-2-quinolin-3-yloxypropanamide (PubChem CID 166236275) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2S)-N-[(2S,3R)-2-ethenyloxan-3-yl]-2-quinolin-3-yloxypropanamide.
| Compound Name | (2S)-N-[(2S,3R)-2-ethenyloxan-3-yl]-2-quinolin-3-yloxypropanamide |
|---|---|
| PubChem CID | 166236275 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2S)-N-[(2S,3R)-2-ethenyloxan-3-yl]-2-quinolin-3-yloxypropanamide |
| SMILES | C=C[C@@H]1OCCC[C@H]1NC(=O)[C@H](C)Oc1cnc2ccccc2c1 |
| InChI | InChI=1S/C19H22N2O3/c1-3-18-17(9-6-10-23-18)21-19(22)13(2)24-15-11-14-7-4-5-8-16(14)20-12-15/h3-5,7-8,11-13,17-18H,1,6,9-10H2,2H3,(H,21,22)/t13-,17+,18-/m0/s1 |
| InChIKey | PANVFYKWPNHRSA-VHSSKADRSA-N |
| XLogP | 2.85 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|