C12H14ClN3O2 — CID 166236300
5-chloro-6-[3-hydroxy-4-(hydroxymethyl)pyrrolidin-1-yl]-2-methylpyridine-3-carbonitrile (PubChem CID 166236300) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 5-chloro-6-[3-hydroxy-4-(hydroxymethyl)pyrrolidin-1-yl]-2-methylpyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[3-hydroxy-4-(hydroxymethyl)pyrrolidin-1-yl]-2-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166236300 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-chloro-6-[3-hydroxy-4-(hydroxymethyl)pyrrolidin-1-yl]-2-methylpyridine-3-carbonitrile |
| SMILES | Cc1nc(N2CC(O)C(CO)C2)c(Cl)cc1C#N |
| InChI | InChI=1S/C12H14ClN3O2/c1-7-8(3-14)2-10(13)12(15-7)16-4-9(6-17)11(18)5-16/h2,9,11,17-18H,4-6H2,1H3 |
| InChIKey | OZJGFRFWWZFAFI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |