About 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid
5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid (PubChem CID 134707159) has the molecular formula C13H18ClN3O5S
and a molecular weight of 363.82 g/mol. Its IUPAC name is 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid |
| PubChem CID | 134707159 |
| Molecular Formula | C13H18ClN3O5S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1CN(c2ncc(C(=O)O)cc2Cl)C[C@H]1O |
| InChI | InChI=1S/C13H18ClN3O5S/c1-16(2)23(21,22)7-9-5-17(6-11(9)18)12-10(14)3-8(4-15-12)13(19)20/h3-4,9,11,18H,5-7H2,1-2H3,(H,19,20)/t9-,11+/m0/s1 |
| InChIKey | IBZIZGLUYFHHIB-GXSJLCMTSA-N |
| XLogP | 0.12 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid?
The IUPAC name of 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid (CID 134707159) is 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid.
What is the SMILES notation for 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid?
The canonical SMILES for 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid is CN(C)S(=O)(=O)C[C@@H]1CN(c2ncc(C(=O)O)cc2Cl)C[C@H]1O.
What is the InChIKey of 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid?
The InChIKey is IBZIZGLUYFHHIB-GXSJLCMTSA-N. The full InChI is InChI=1S/C13H18ClN3O5S/c1-16(2)23(21,22)7-9-5-17(6-11(9)18)12-10(14)3-8(4-15-12)13(19)20/h3-4,9,11,18H,5-7H2,1-2H3,(H,19,20)/t9-,11+/m0/s1.
What are the key properties of 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid?
5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid has a molecular weight of 363.82 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-[(3R,4S)-3-(dimethylsulfamoylmethyl)-4-hydroxypyrrolidin-1-yl]pyridine-3-carboxylic acid is sourced from PubChem (CID 134707159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).