C21H26N4O3 — CID 166237377
N'-(4-aminophenyl)-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]oxamide (PubChem CID 166237377) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N'-(4-aminophenyl)-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]oxamide.
| Compound Name | N'-(4-aminophenyl)-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]oxamide |
|---|---|
| PubChem CID | 166237377 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N'-(4-aminophenyl)-N-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]oxamide |
| SMILES | Cc1cccc(C(CNC(=O)C(=O)Nc2ccc(N)cc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H26N4O3/c1-15-3-2-4-16(13-15)19(25-9-11-28-12-10-25)14-23-20(26)21(27)24-18-7-5-17(22)6-8-18/h2-8,13,19H,9-12,14,22H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | JVWICIIOCFXIQD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|