C14H15F3IN — CID 166237791
7,7-difluoro-3-[(4-fluoro-2-iodophenyl)methyl]-6-methyl-3-azabicyclo[4.1.0]heptane (PubChem CID 166237791) has the molecular formula C14H15F3IN and a molecular weight of 381.18 g/mol. Its IUPAC name is 7,7-difluoro-3-[(4-fluoro-2-iodophenyl)methyl]-6-methyl-3-azabicyclo[4.1.0]heptane.
| Compound Name | 7,7-difluoro-3-[(4-fluoro-2-iodophenyl)methyl]-6-methyl-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 166237791 |
| Molecular Formula | C14H15F3IN |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 7,7-difluoro-3-[(4-fluoro-2-iodophenyl)methyl]-6-methyl-3-azabicyclo[4.1.0]heptane |
| SMILES | CC12CCN(Cc3ccc(F)cc3I)CC1C2(F)F |
| InChI | InChI=1S/C14H15F3IN/c1-13-4-5-19(8-12(13)14(13,16)17)7-9-2-3-10(15)6-11(9)18/h2-3,6,12H,4-5,7-8H2,1H3 |
| InChIKey | NIGOPCZPAHWHRQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|