C15H26N4O2 — CID 166238441
1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-[(3S)-3-methylpiperazin-1-yl]ethane-1,2-dione (PubChem CID 166238441) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-[(3S)-3-methylpiperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-[(3S)-3-methylpiperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 166238441 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-[(3S)-3-methylpiperazin-1-yl]ethane-1,2-dione |
| SMILES | C[C@H]1CN(C(=O)C(=O)N2CCN(CC3CC3)CC2)CCN1 |
| InChI | InChI=1S/C15H26N4O2/c1-12-10-19(5-4-16-12)15(21)14(20)18-8-6-17(7-9-18)11-13-2-3-13/h12-13,16H,2-11H2,1H3/t12-/m0/s1 |
| InChIKey | ZIWNFKALUXBVGS-LBPRGKRZSA-N |
| XLogP | -0.64 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|