C15H31ClN4O — CID 120849270
N-tert-butyl-4-(piperidin-4-ylmethyl)piperazine-1-carboxamide;hydrochloride (PubChem CID 120849270) has the molecular formula C15H31ClN4O and a molecular weight of 318.89 g/mol. Its IUPAC name is N-tert-butyl-4-(piperidin-4-ylmethyl)piperazine-1-carboxamide;hydrochloride.
| Compound Name | N-tert-butyl-4-(piperidin-4-ylmethyl)piperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120849270 |
| Molecular Formula | C15H31ClN4O |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | N-tert-butyl-4-(piperidin-4-ylmethyl)piperazine-1-carboxamide;hydrochloride |
| SMILES | CC(C)(C)NC(=O)N1CCN(CC2CCNCC2)CC1.Cl |
| InChI | InChI=1S/C15H30N4O.ClH/c1-15(2,3)17-14(20)19-10-8-18(9-11-19)12-13-4-6-16-7-5-13;/h13,16H,4-12H2,1-3H3,(H,17,20);1H |
| InChIKey | FNRBEUJATYAELF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |