C14H20N2O4S2 — CID 166239263
N-(2-bicyclo[4.1.0]heptanyl)-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 166239263) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(2-bicyclo[4.1.0]heptanyl)-4-(methanesulfonamido)benzenesulfonamide.
| Compound Name | N-(2-bicyclo[4.1.0]heptanyl)-4-(methanesulfonamido)benzenesulfonamide |
|---|---|
| PubChem CID | 166239263 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(2-bicyclo[4.1.0]heptanyl)-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(S(=O)(=O)NC2CCCC3CC32)cc1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-21(17,18)15-11-5-7-12(8-6-11)22(19,20)16-14-4-2-3-10-9-13(10)14/h5-8,10,13-16H,2-4,9H2,1H3 |
| InChIKey | UZUAKJQPVCHJCI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |