C13H15F2NO5S — CID 166239334
2-[4-[(3,5-difluorophenyl)sulfonylamino]oxan-4-yl]acetic acid (PubChem CID 166239334) has the molecular formula C13H15F2NO5S and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[4-[(3,5-difluorophenyl)sulfonylamino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[(3,5-difluorophenyl)sulfonylamino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 166239334 |
| Molecular Formula | C13H15F2NO5S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[4-[(3,5-difluorophenyl)sulfonylamino]oxan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NS(=O)(=O)c2cc(F)cc(F)c2)CCOCC1 |
| InChI | InChI=1S/C13H15F2NO5S/c14-9-5-10(15)7-11(6-9)22(19,20)16-13(8-12(17)18)1-3-21-4-2-13/h5-7,16H,1-4,8H2,(H,17,18) |
| InChIKey | DXBSRKXFLFMONQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |