C19H27KN2O4 — CID 166240274
potassium 2-(3-methoxycyclohexyl)-2-[(3-propan-2-ylphenyl)carbamoylamino]acetate (PubChem CID 166240274) has the molecular formula C19H27KN2O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is potassium 2-(3-methoxycyclohexyl)-2-[(3-propan-2-ylphenyl)carbamoylamino]acetate.
| Compound Name | potassium 2-(3-methoxycyclohexyl)-2-[(3-propan-2-ylphenyl)carbamoylamino]acetate |
|---|---|
| PubChem CID | 166240274 |
| Molecular Formula | C19H27KN2O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | potassium 2-(3-methoxycyclohexyl)-2-[(3-propan-2-ylphenyl)carbamoylamino]acetate |
| SMILES | COC1CCCC(C(NC(=O)Nc2cccc(C(C)C)c2)C(=O)[O-])C1.[K+] |
| InChI | InChI=1S/C19H28N2O4.K/c1-12(2)13-6-4-8-15(10-13)20-19(24)21-17(18(22)23)14-7-5-9-16(11-14)25-3;/h4,6,8,10,12,14,16-17H,5,7,9,11H2,1-3H3,(H,22,23)(H2,20,21,24);/q;+1/p-1 |
| InChIKey | ZHQLZIGIUUFWDT-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |