C20H16N4OS — CID 16624078
2-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]indolizine-1-carbonitrile (PubChem CID 16624078) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]indolizine-1-carbonitrile.
| Compound Name | 2-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 16624078 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-[(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]indolizine-1-carbonitrile |
| SMILES | N#Cc1c(Cn2cnc3sc4c(c3c2=O)CCCC4)cn2ccccc12 |
| InChI | InChI=1S/C20H16N4OS/c21-9-15-13(10-23-8-4-3-6-16(15)23)11-24-12-22-19-18(20(24)25)14-5-1-2-7-17(14)26-19/h3-4,6,8,10,12H,1-2,5,7,11H2 |
| InChIKey | LRROWKLFPYGCSZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_pyridone_A(3)', 'substructure': 'N/A'} |
|---|