C23H28N4O2 — CID 166240926
2-(3-anilinopyrrolidin-1-yl)-2-oxo-N-[2-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]acetamide (PubChem CID 166240926) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(3-anilinopyrrolidin-1-yl)-2-oxo-N-[2-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]acetamide.
| Compound Name | 2-(3-anilinopyrrolidin-1-yl)-2-oxo-N-[2-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 166240926 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-(3-anilinopyrrolidin-1-yl)-2-oxo-N-[2-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]acetamide |
| SMILES | O=C(NCCC1CCc2ccccc2N1)C(=O)N1CCC(Nc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N4O2/c28-22(24-14-12-19-11-10-17-6-4-5-9-21(17)26-19)23(29)27-15-13-20(16-27)25-18-7-2-1-3-8-18/h1-9,19-20,25-26H,10-16H2,(H,24,28) |
| InChIKey | LWNOCOLSUKKQQK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|