C21H18N4O2 — CID 16624144
2-[[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile (PubChem CID 16624144) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile.
| Compound Name | 2-[[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 16624144 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile |
| SMILES | Cc1ccc(C2(C)NC(=O)N(Cc3cn4ccccc4c3C#N)C2=O)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-14-6-8-16(9-7-14)21(2)19(26)25(20(27)23-21)13-15-12-24-10-4-3-5-18(24)17(15)11-22/h3-10,12H,13H2,1-2H3,(H,23,27) |
| InChIKey | NKWUUXNFNQDWMI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|