C21H16F2N4O3 — CID 16624154
2-[[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile (PubChem CID 16624154) has the molecular formula C21H16F2N4O3 and a molecular weight of 410.38 g/mol. Its IUPAC name is 2-[[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile.
| Compound Name | 2-[[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 16624154 |
| Molecular Formula | C21H16F2N4O3 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]indolizine-1-carbonitrile |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(Cc2cn3ccccc3c2C#N)C1=O |
| InChI | InChI=1S/C21H16F2N4O3/c1-21(14-5-7-15(8-6-14)30-19(22)23)18(28)27(20(29)25-21)12-13-11-26-9-3-2-4-17(26)16(13)10-24/h2-9,11,19H,12H2,1H3,(H,25,29) |
| InChIKey | NLBMDXFAFXWCJN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|