C14H18N2O3S — CID 166241564
6-[3-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2,3-dihydroinden-1-one (PubChem CID 166241564) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 6-[3-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2,3-dihydroinden-1-one.
| Compound Name | 6-[3-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 166241564 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 6-[3-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2,3-dihydroinden-1-one |
| SMILES | NCC1CCN(S(=O)(=O)c2ccc3c(c2)C(=O)CC3)C1 |
| InChI | InChI=1S/C14H18N2O3S/c15-8-10-5-6-16(9-10)20(18,19)12-3-1-11-2-4-14(17)13(11)7-12/h1,3,7,10H,2,4-6,8-9,15H2 |
| InChIKey | XIZANHLOZTVSAF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |