C18H22N6 — CID 166243479
6-(4,6-dimethyl-1,4-diazepan-1-yl)-9-phenylpurine (PubChem CID 166243479) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 6-(4,6-dimethyl-1,4-diazepan-1-yl)-9-phenylpurine.
| Compound Name | 6-(4,6-dimethyl-1,4-diazepan-1-yl)-9-phenylpurine |
|---|---|
| PubChem CID | 166243479 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 6-(4,6-dimethyl-1,4-diazepan-1-yl)-9-phenylpurine |
| SMILES | CC1CN(C)CCN(c2ncnc3c2ncn3-c2ccccc2)C1 |
| InChI | InChI=1S/C18H22N6/c1-14-10-22(2)8-9-23(11-14)17-16-18(20-12-19-17)24(13-21-16)15-6-4-3-5-7-15/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | NKCRNHMMWQWQSR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |