C19H24N8O2 — CID 166243700
N'-methyl-N,N'-bis(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)hexane-1,6-diamine (PubChem CID 166243700) has the molecular formula C19H24N8O2 and a molecular weight of 396.46 g/mol. Its IUPAC name is N'-methyl-N,N'-bis(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)hexane-1,6-diamine.
| Compound Name | N'-methyl-N,N'-bis(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 166243700 |
| Molecular Formula | C19H24N8O2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N'-methyl-N,N'-bis(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)hexane-1,6-diamine |
| SMILES | Cc1noc2ncnc(NCCCCCCN(C)c3ncnc4onc(C)c34)c12 |
| InChI | InChI=1S/C19H24N8O2/c1-12-14-16(21-10-23-18(14)28-25-12)20-8-6-4-5-7-9-27(3)17-15-13(2)26-29-19(15)24-11-22-17/h10-11H,4-9H2,1-3H3,(H,20,21,23) |
| InChIKey | RIQMXHJVNDMFSF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|