C18H23N5O — CID 20924698
N'-benzyl-N'-ethyl-N-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)propane-1,3-diamine (PubChem CID 20924698) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N'-benzyl-N'-ethyl-N-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-ethyl-N-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 20924698 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N'-benzyl-N'-ethyl-N-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)propane-1,3-diamine |
| SMILES | CCN(CCCNc1ncnc2onc(C)c12)Cc1ccccc1 |
| InChI | InChI=1S/C18H23N5O/c1-3-23(12-15-8-5-4-6-9-15)11-7-10-19-17-16-14(2)22-24-18(16)21-13-20-17/h4-6,8-9,13H,3,7,10-12H2,1-2H3,(H,19,20,21) |
| InChIKey | PSTPRVLRMYJQFG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|