C20H19ClN4O — CID 166245513
N-[1-(3-chlorophenyl)cyclopentyl]-5-phenyl-2H-triazole-4-carboxamide (PubChem CID 166245513) has the molecular formula C20H19ClN4O and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)cyclopentyl]-5-phenyl-2H-triazole-4-carboxamide.
| Compound Name | N-[1-(3-chlorophenyl)cyclopentyl]-5-phenyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 166245513 |
| Molecular Formula | C20H19ClN4O |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[1-(3-chlorophenyl)cyclopentyl]-5-phenyl-2H-triazole-4-carboxamide |
| SMILES | O=C(NC1(c2cccc(Cl)c2)CCCC1)c1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C20H19ClN4O/c21-16-10-6-9-15(13-16)20(11-4-5-12-20)22-19(26)18-17(23-25-24-18)14-7-2-1-3-8-14/h1-3,6-10,13H,4-5,11-12H2,(H,22,26)(H,23,24,25) |
| InChIKey | JWQKHSBHNRVFSY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |