C23H23N5O — CID 166248513
6-[4-(2-pyrazin-2-ylethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepine (PubChem CID 166248513) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 6-[4-(2-pyrazin-2-ylethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepine.
| Compound Name | 6-[4-(2-pyrazin-2-ylethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 166248513 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 6-[4-(2-pyrazin-2-ylethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepine |
| SMILES | c1ccc2c(c1)N=C(N1CCN(CCc3cnccn3)CC1)c1ccccc1O2 |
| InChI | InChI=1S/C23H23N5O/c1-3-7-21-19(5-1)23(26-20-6-2-4-8-22(20)29-21)28-15-13-27(14-16-28)12-9-18-17-24-10-11-25-18/h1-8,10-11,17H,9,12-16H2 |
| InChIKey | LCIHWFLNGDJHEF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |