C24H23N3O3S — CID 46335399
6-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]benzo[b][1,4]benzoxazepine (PubChem CID 46335399) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 6-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]benzo[b][1,4]benzoxazepine.
| Compound Name | 6-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]benzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 46335399 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 6-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]benzo[b][1,4]benzoxazepine |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCN(C2=Nc3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C24H23N3O3S/c1-18-8-2-7-13-23(18)31(28,29)27-16-14-26(15-17-27)24-19-9-3-5-11-21(19)30-22-12-6-4-10-20(22)25-24/h2-13H,14-17H2,1H3 |
| InChIKey | XTQGCKGYVUTNFY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |