C21H23N3O4 — CID 167859936
1-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2,2-dimethoxyethanone (PubChem CID 167859936) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2,2-dimethoxyethanone.
| Compound Name | 1-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 167859936 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2,2-dimethoxyethanone |
| SMILES | COC(OC)C(=O)N1CCN(C2=Nc3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C21H23N3O4/c1-26-21(27-2)20(25)24-13-11-23(12-14-24)19-15-7-3-5-9-17(15)28-18-10-6-4-8-16(18)22-19/h3-10,21H,11-14H2,1-2H3 |
| InChIKey | FWPLLQBFKSAIOT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|