C25H28N2O2S — CID 122651374
1-[4-(2,3-dimethylphenyl)phenyl]-4-(2-methylphenyl)sulfonylpiperazine (PubChem CID 122651374) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)phenyl]-4-(2-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-[4-(2,3-dimethylphenyl)phenyl]-4-(2-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 122651374 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)phenyl]-4-(2-methylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCN(c2ccc(-c3cccc(C)c3C)cc2)CC1 |
| InChI | InChI=1S/C25H28N2O2S/c1-19-8-6-9-24(21(19)3)22-11-13-23(14-12-22)26-15-17-27(18-16-26)30(28,29)25-10-5-4-7-20(25)2/h4-14H,15-18H2,1-3H3 |
| InChIKey | MQKFLOVSJJPFKW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |