C21H29N3O2S — CID 113078885
N,N-diethyl-4-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]aniline (PubChem CID 113078885) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is N,N-diethyl-4-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]aniline.
| Compound Name | N,N-diethyl-4-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]aniline |
|---|---|
| PubChem CID | 113078885 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N,N-diethyl-4-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]aniline |
| SMILES | CCN(CC)c1ccc(N2CCN(S(=O)(=O)c3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O2S/c1-4-22(5-2)19-10-12-20(13-11-19)23-14-16-24(17-15-23)27(25,26)21-9-7-6-8-18(21)3/h6-13H,4-5,14-17H2,1-3H3 |
| InChIKey | ZLKWTASIIUHLEF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|