C19H26N2O4 — CID 166249031
[(E)-4-(5-methoxy-3-pyridinyl)but-3-enyl] 3-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 166249031) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [(E)-4-(5-methoxy-3-pyridinyl)but-3-enyl] 3-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | [(E)-4-(5-methoxy-3-pyridinyl)but-3-enyl] 3-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 166249031 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [(E)-4-(5-methoxy-3-pyridinyl)but-3-enyl] 3-(2-methylpropyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | COc1cncc(/C=C/CCOC(=O)C2(CC(C)C)CCNC2=O)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-14(2)11-19(7-8-21-17(19)22)18(23)25-9-5-4-6-15-10-16(24-3)13-20-12-15/h4,6,10,12-14H,5,7-9,11H2,1-3H3,(H,21,22)/b6-4+ |
| InChIKey | PWWAJDQYMXKWFS-GQCTYLIASA-N |
| XLogP | 2.59 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|