C21H26FN3O3 — CID 166249045
4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]butan-1-one (PubChem CID 166249045) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]butan-1-one.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]butan-1-one |
|---|---|
| PubChem CID | 166249045 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(1R,6S,7S)-7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl]butan-1-one |
| SMILES | CC1(C)[C@@H](O)[C@H]2CCCN(C(=O)CCCc3nc(-c4ccc(F)cc4)no3)[C@H]21 |
| InChI | InChI=1S/C21H26FN3O3/c1-21(2)18-15(19(21)27)5-4-12-25(18)17(26)7-3-6-16-23-20(24-28-16)13-8-10-14(22)11-9-13/h8-11,15,18-19,27H,3-7,12H2,1-2H3/t15-,18+,19-/m0/s1 |
| InChIKey | UOOCSDRLIMINIA-IPELMVKDSA-N |
| XLogP | 3.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |