C12H17ClN2O3S — CID 166249626
N-[3-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-sulfonamide (PubChem CID 166249626) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-sulfonamide.
| Compound Name | N-[3-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-sulfonamide |
|---|---|
| PubChem CID | 166249626 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-[3-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-sulfonamide |
| SMILES | O=S(=O)(NCC(O)Cc1cccc(Cl)c1)N1CCC1 |
| InChI | InChI=1S/C12H17ClN2O3S/c13-11-4-1-3-10(7-11)8-12(16)9-14-19(17,18)15-5-2-6-15/h1,3-4,7,12,14,16H,2,5-6,8-9H2 |
| InChIKey | VTVNQCSYTHPQPZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |