C17H19FN2O3 — CID 166251068
1-(6-fluoro-1H-indol-3-yl)-2-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]ethane-1,2-dione (PubChem CID 166251068) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-(6-fluoro-1H-indol-3-yl)-2-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(6-fluoro-1H-indol-3-yl)-2-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 166251068 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(6-fluoro-1H-indol-3-yl)-2-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]ethane-1,2-dione |
| SMILES | CC1(CO)CCN(C(=O)C(=O)c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C17H19FN2O3/c1-17(10-21)4-6-20(7-5-17)16(23)15(22)13-9-19-14-8-11(18)2-3-12(13)14/h2-3,8-9,19,21H,4-7,10H2,1H3 |
| InChIKey | MSYKIKYWKAJOPG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|