C17H14F2N6S — CID 16625171
1-(difluoromethyl)-2-[[1-(3-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole (PubChem CID 16625171) has the molecular formula C17H14F2N6S and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-[[1-(3-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole.
| Compound Name | 1-(difluoromethyl)-2-[[1-(3-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole |
|---|---|
| PubChem CID | 16625171 |
| Molecular Formula | C17H14F2N6S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-(difluoromethyl)-2-[[1-(3-methylphenyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole |
| SMILES | Cc1cccc(-n2nnnc2SCc2nc3ccccc3n2C(F)F)c1 |
| InChI | InChI=1S/C17H14F2N6S/c1-11-5-4-6-12(9-11)25-17(21-22-23-25)26-10-15-20-13-7-2-3-8-14(13)24(15)16(18)19/h2-9,16H,10H2,1H3 |
| InChIKey | RTAUOUQRARMNFB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |