C19H18F2N4OS — CID 24629504
1-(difluoromethyl)-2-[[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylmethyl]benzimidazole (PubChem CID 24629504) has the molecular formula C19H18F2N4OS and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-[[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylmethyl]benzimidazole.
| Compound Name | 1-(difluoromethyl)-2-[[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylmethyl]benzimidazole |
|---|---|
| PubChem CID | 24629504 |
| Molecular Formula | C19H18F2N4OS |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-(difluoromethyl)-2-[[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylmethyl]benzimidazole |
| SMILES | COCCn1c(SCc2nc3ccccc3n2C(F)F)nc2ccccc21 |
| InChI | InChI=1S/C19H18F2N4OS/c1-26-11-10-24-15-8-4-2-6-13(15)23-19(24)27-12-17-22-14-7-3-5-9-16(14)25(17)18(20)21/h2-9,18H,10-12H2,1H3 |
| InChIKey | OBWRVJQFJYNUGS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |