C16H23N3OS — CID 166253641
dimethyl-[1-[[2-(2-methylpropyl)phenyl]methyl]pyrazol-4-yl]imino-oxo-λ6-sulfane (PubChem CID 166253641) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is dimethyl-[1-[[2-(2-methylpropyl)phenyl]methyl]pyrazol-4-yl]imino-oxo-λ6-sulfane.
| Compound Name | dimethyl-[1-[[2-(2-methylpropyl)phenyl]methyl]pyrazol-4-yl]imino-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 166253641 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | dimethyl-[1-[[2-(2-methylpropyl)phenyl]methyl]pyrazol-4-yl]imino-oxo-λ6-sulfane |
| SMILES | CC(C)Cc1ccccc1Cn1cc(N=S(C)(C)=O)cn1 |
| InChI | InChI=1S/C16H23N3OS/c1-13(2)9-14-7-5-6-8-15(14)11-19-12-16(10-17-19)18-21(3,4)20/h5-8,10,12-13H,9,11H2,1-4H3 |
| InChIKey | KLBHTBONCNCKGH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |