C14H17N3O3S — CID 126837457
methyl 2-[[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyrazol-1-yl]methyl]benzoate (PubChem CID 126837457) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is methyl 2-[[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 126837457 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 2-[[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]pyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1cc(N=S(C)(C)=O)cn1 |
| InChI | InChI=1S/C14H17N3O3S/c1-20-14(18)13-7-5-4-6-11(13)9-17-10-12(8-15-17)16-21(2,3)19/h4-8,10H,9H2,1-3H3 |
| InChIKey | XXRWFOHNFREJKU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |