C18H17NO4S — CID 166253767
4-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]sulfamoyl]-3-methylbenzoic acid (PubChem CID 166253767) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]sulfamoyl]-3-methylbenzoic acid.
| Compound Name | 4-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]sulfamoyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 166253767 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]sulfamoyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1S(=O)(=O)N[C@@H]1[C@H]2Cc3ccccc3[C@H]21 |
| InChI | InChI=1S/C18H17NO4S/c1-10-8-12(18(20)21)6-7-15(10)24(22,23)19-17-14-9-11-4-2-3-5-13(11)16(14)17/h2-8,14,16-17,19H,9H2,1H3,(H,20,21)/t14-,16+,17+/m0/s1 |
| InChIKey | XOMKEUAEEPJWJO-USXIJHARSA-N |
| XLogP | 2.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |