C17H21NO4 — CID 166253828
(3S)-3-(1,3-benzodioxol-5-yl)-3-(cyclohex-3-en-1-ylmethylamino)propanoic acid (PubChem CID 166253828) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yl)-3-(cyclohex-3-en-1-ylmethylamino)propanoic acid.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-(cyclohex-3-en-1-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 166253828 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-(cyclohex-3-en-1-ylmethylamino)propanoic acid |
| SMILES | O=C(O)C[C@H](NCC1CC=CCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H21NO4/c19-17(20)9-14(18-10-12-4-2-1-3-5-12)13-6-7-15-16(8-13)22-11-21-15/h1-2,6-8,12,14,18H,3-5,9-11H2,(H,19,20)/t12?,14-/m0/s1 |
| InChIKey | LOWGZIANYCJTLL-PYMCNQPYSA-N |
| XLogP | 2.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|