C18H24N2O3 — CID 60591630
1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea (PubChem CID 60591630) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea |
|---|---|
| PubChem CID | 60591630 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]urea |
| SMILES | CC(NC(=O)NCC1CC=CCC1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H24N2O3/c1-13(15-7-8-16-17(11-15)23-10-9-22-16)20-18(21)19-12-14-5-3-2-4-6-14/h2-3,7-8,11,13-14H,4-6,9-10,12H2,1H3,(H2,19,20,21) |
| InChIKey | GEIYNQJZMBVTOB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|