C20H27N3O3 — CID 127386032
1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]urea (PubChem CID 127386032) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]urea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]urea |
|---|---|
| PubChem CID | 127386032 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]urea |
| SMILES | CCC1Oc2cc(C(C)NC(=O)NCC3CC=CCC3)ccc2NC1=O |
| InChI | InChI=1S/C20H27N3O3/c1-3-17-19(24)23-16-10-9-15(11-18(16)26-17)13(2)22-20(25)21-12-14-7-5-4-6-8-14/h4-5,9-11,13-14,17H,3,6-8,12H2,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | YBXQVWRAYPZJKK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|