C17H24N2O3S — CID 96519987
N-[(1R)-1-[(2R)-2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl]ethyl]-2-propylsulfanylacetamide (PubChem CID 96519987) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[(1R)-1-[(2R)-2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl]ethyl]-2-propylsulfanylacetamide.
| Compound Name | N-[(1R)-1-[(2R)-2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl]ethyl]-2-propylsulfanylacetamide |
|---|---|
| PubChem CID | 96519987 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[(1R)-1-[(2R)-2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl]ethyl]-2-propylsulfanylacetamide |
| SMILES | CCCSCC(=O)N[C@H](C)c1ccc2c(c1)O[C@H](CC)C(=O)N2 |
| InChI | InChI=1S/C17H24N2O3S/c1-4-8-23-10-16(20)18-11(3)12-6-7-13-15(9-12)22-14(5-2)17(21)19-13/h6-7,9,11,14H,4-5,8,10H2,1-3H3,(H,18,20)(H,19,21)/t11-,14-/m1/s1 |
| InChIKey | LGVJSMLBYZAOOU-BXUZGUMPSA-N |
| XLogP | 3.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|