C23H22N4O4 — CID 167767848
N'-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-N-quinolin-8-yloxamide (PubChem CID 167767848) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N'-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-N-quinolin-8-yloxamide.
| Compound Name | N'-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-N-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 167767848 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N'-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-N-quinolin-8-yloxamide |
| SMILES | CCC1Oc2cc(C(C)NC(=O)C(=O)Nc3cccc4cccnc34)ccc2NC1=O |
| InChI | InChI=1S/C23H22N4O4/c1-3-18-21(28)26-16-10-9-15(12-19(16)31-18)13(2)25-22(29)23(30)27-17-8-4-6-14-7-5-11-24-20(14)17/h4-13,18H,3H2,1-2H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | GTYWHLQENHTKJH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|