C17H25N3O3 — CID 119806809
N-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-4-(methylamino)butanamide (PubChem CID 119806809) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-4-(methylamino)butanamide.
| Compound Name | N-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119806809 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[1-(2-ethyl-3-oxo-4H-1,4-benzoxazin-7-yl)ethyl]-4-(methylamino)butanamide |
| SMILES | CCC1Oc2cc(C(C)NC(=O)CCCNC)ccc2NC1=O |
| InChI | InChI=1S/C17H25N3O3/c1-4-14-17(22)20-13-8-7-12(10-15(13)23-14)11(2)19-16(21)6-5-9-18-3/h7-8,10-11,14,18H,4-6,9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | XJLTXERFEALMNN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|