About 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea
1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea (PubChem CID 166255488) has the molecular formula C15H30N4O2
and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea.
Molecular Properties
| Compound Name | 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea |
| PubChem CID | 166255488 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea |
| SMILES | CC1C(NC(=O)N[C@@H]2CCN(CC(C)(C)O)C2)CCN1C |
| InChI | InChI=1S/C15H30N4O2/c1-11-13(6-7-18(11)4)17-14(20)16-12-5-8-19(9-12)10-15(2,3)21/h11-13,21H,5-10H2,1-4H3,(H2,16,17,20)/t11?,12-,13?/m1/s1 |
| InChIKey | IYHZQMOEFKKGAJ-OTTFEQOBSA-N |
| XLogP | 0.22 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea?
The IUPAC name of 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea (CID 166255488) is 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea.
What is the SMILES notation for 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea?
The canonical SMILES for 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea is CC1C(NC(=O)N[C@@H]2CCN(CC(C)(C)O)C2)CCN1C.
What is the InChIKey of 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea?
The InChIKey is IYHZQMOEFKKGAJ-OTTFEQOBSA-N. The full InChI is InChI=1S/C15H30N4O2/c1-11-13(6-7-18(11)4)17-14(20)16-12-5-8-19(9-12)10-15(2,3)21/h11-13,21H,5-10H2,1-4H3,(H2,16,17,20)/t11?,12-,13?/m1/s1.
What are the key properties of 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea?
1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea has a molecular weight of 298.43 g/mol, XLogP of 0.22, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dimethylpyrrolidin-3-yl)-3-[(3R)-1-(2-hydroxy-2-methylpropyl)pyrrolidin-3-yl]urea is sourced from PubChem (CID 166255488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).