C22H27N5O2 — CID 166255520
3-[1H-benzimidazol-2-yl(cyclohexyl)methyl]-1-methyl-1-[(6-oxo-1H-pyridin-2-yl)methyl]urea (PubChem CID 166255520) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[1H-benzimidazol-2-yl(cyclohexyl)methyl]-1-methyl-1-[(6-oxo-1H-pyridin-2-yl)methyl]urea.
| Compound Name | 3-[1H-benzimidazol-2-yl(cyclohexyl)methyl]-1-methyl-1-[(6-oxo-1H-pyridin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 166255520 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-[1H-benzimidazol-2-yl(cyclohexyl)methyl]-1-methyl-1-[(6-oxo-1H-pyridin-2-yl)methyl]urea |
| SMILES | CN(Cc1cccc(=O)[nH]1)C(=O)NC(c1nc2ccccc2[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C22H27N5O2/c1-27(14-16-10-7-13-19(28)23-16)22(29)26-20(15-8-3-2-4-9-15)21-24-17-11-5-6-12-18(17)25-21/h5-7,10-13,15,20H,2-4,8-9,14H2,1H3,(H,23,28)(H,24,25)(H,26,29) |
| InChIKey | JNULEIFYQRAWLU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |