C16H19N3OS — CID 166256732
1-benzyl-4-methyl-N-(1,2-thiazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 166256732) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-benzyl-4-methyl-N-(1,2-thiazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-4-methyl-N-(1,2-thiazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166256732 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-benzyl-4-methyl-N-(1,2-thiazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | CC1CN(Cc2ccccc2)CC1C(=O)Nc1cnsc1 |
| InChI | InChI=1S/C16H19N3OS/c1-12-8-19(9-13-5-3-2-4-6-13)10-15(12)16(20)18-14-7-17-21-11-14/h2-7,11-12,15H,8-10H2,1H3,(H,18,20) |
| InChIKey | OQDHTJZAZNRPSG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |